C15H20ClF3N2 — CID 170862929
1-[3-[4-chloro-2-(trifluoromethyl)phenyl]propyl]-4-methylpiperazine (PubChem CID 170862929) has the molecular formula C15H20ClF3N2 and a molecular weight of 320.79 g/mol. Its IUPAC name is 1-[3-[4-chloro-2-(trifluoromethyl)phenyl]propyl]-4-methylpiperazine.
| Compound Name | 1-[3-[4-chloro-2-(trifluoromethyl)phenyl]propyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 170862929 |
| Molecular Formula | C15H20ClF3N2 |
| Molecular Weight | 320.79 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-[3-[4-chloro-2-(trifluoromethyl)phenyl]propyl]-4-methylpiperazine |
| SMILES | CN1CCN(CCCc2ccc(Cl)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H20ClF3N2/c1-20-7-9-21(10-8-20)6-2-3-12-4-5-13(16)11-14(12)15(17,18)19/h4-5,11H,2-3,6-10H2,1H3 |
| InChIKey | QECKDWWEHMAMCR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.79 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |