C11H10ClF3O2 — CID 117108466
4-[4-chloro-2-(trifluoromethyl)phenyl]butanoic acid (PubChem CID 117108466) has the molecular formula C11H10ClF3O2 and a molecular weight of 266.65 g/mol. Its IUPAC name is 4-[4-chloro-2-(trifluoromethyl)phenyl]butanoic acid.
| Compound Name | 4-[4-chloro-2-(trifluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 117108466 |
| Molecular Formula | C11H10ClF3O2 |
| Molecular Weight | 266.65 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 4-[4-chloro-2-(trifluoromethyl)phenyl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C11H10ClF3O2/c12-8-5-4-7(2-1-3-10(16)17)9(6-8)11(13,14)15/h4-6H,1-3H2,(H,16,17) |
| InChIKey | YVXUNXBULCMTPL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |