C22H22F6O3 — CID 161321713
4-[2-(trifluoromethyl)phenyl]butanal;4-[2-(trifluoromethyl)phenyl]butanoic acid (PubChem CID 161321713) has the molecular formula C22H22F6O3 and a molecular weight of 448.40 g/mol. Its IUPAC name is 4-[2-(trifluoromethyl)phenyl]butanal;4-[2-(trifluoromethyl)phenyl]butanoic acid.
| Compound Name | 4-[2-(trifluoromethyl)phenyl]butanal;4-[2-(trifluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 161321713 |
| Molecular Formula | C22H22F6O3 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 4-[2-(trifluoromethyl)phenyl]butanal;4-[2-(trifluoromethyl)phenyl]butanoic acid |
| SMILES | O=C(O)CCCc1ccccc1C(F)(F)F.O=CCCCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H11F3O2.C11H11F3O/c12-11(13,14)9-6-2-1-4-8(9)5-3-7-10(15)16;12-11(13,14)10-7-2-1-5-9(10)6-3-4-8-15/h1-2,4,6H,3,5,7H2,(H,15,16);1-2,5,7-8H,3-4,6H2 |
| InChIKey | VKFPQPCDQRYPBY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|