C14H18F4N2 — CID 170862462
1-methyl-4-[3-(2,3,4,5-tetrafluorophenyl)propyl]piperazine (PubChem CID 170862462) has the molecular formula C14H18F4N2 and a molecular weight of 290.30 g/mol. Its IUPAC name is 1-methyl-4-[3-(2,3,4,5-tetrafluorophenyl)propyl]piperazine.
| Compound Name | 1-methyl-4-[3-(2,3,4,5-tetrafluorophenyl)propyl]piperazine |
|---|---|
| PubChem CID | 170862462 |
| Molecular Formula | C14H18F4N2 |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-methyl-4-[3-(2,3,4,5-tetrafluorophenyl)propyl]piperazine |
| SMILES | CN1CCN(CCCc2cc(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C14H18F4N2/c1-19-5-7-20(8-6-19)4-2-3-10-9-11(15)13(17)14(18)12(10)16/h9H,2-8H2,1H3 |
| InChIKey | KKTWFXZBHNPZKJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|