C15H22F3N3O — CID 170863398
2-[3-(4-methylpiperazin-1-yl)propyl]-4-(trifluoromethoxy)aniline (PubChem CID 170863398) has the molecular formula C15H22F3N3O and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-[3-(4-methylpiperazin-1-yl)propyl]-4-(trifluoromethoxy)aniline.
| Compound Name | 2-[3-(4-methylpiperazin-1-yl)propyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 170863398 |
| Molecular Formula | C15H22F3N3O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-[3-(4-methylpiperazin-1-yl)propyl]-4-(trifluoromethoxy)aniline |
| SMILES | CN1CCN(CCCc2cc(OC(F)(F)F)ccc2N)CC1 |
| InChI | InChI=1S/C15H22F3N3O/c1-20-7-9-21(10-8-20)6-2-3-12-11-13(4-5-14(12)19)22-15(16,17)18/h4-5,11H,2-3,6-10,19H2,1H3 |
| InChIKey | SESAICGIFLEJEX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|