C15H21F3N2S — CID 170863077
1-methyl-4-[3-[2-(trifluoromethylsulfanyl)phenyl]propyl]piperazine (PubChem CID 170863077) has the molecular formula C15H21F3N2S and a molecular weight of 318.41 g/mol. Its IUPAC name is 1-methyl-4-[3-[2-(trifluoromethylsulfanyl)phenyl]propyl]piperazine.
| Compound Name | 1-methyl-4-[3-[2-(trifluoromethylsulfanyl)phenyl]propyl]piperazine |
|---|---|
| PubChem CID | 170863077 |
| Molecular Formula | C15H21F3N2S |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-methyl-4-[3-[2-(trifluoromethylsulfanyl)phenyl]propyl]piperazine |
| SMILES | CN1CCN(CCCc2ccccc2SC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H21F3N2S/c1-19-9-11-20(12-10-19)8-4-6-13-5-2-3-7-14(13)21-15(16,17)18/h2-3,5,7H,4,6,8-12H2,1H3 |
| InChIKey | TUYCHTGLSHCOAQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |