C17H24N2O2 — CID 170863220
(E)-3-[2-[3-(4-methylpiperazin-1-yl)propyl]phenyl]prop-2-enoic acid (PubChem CID 170863220) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (E)-3-[2-[3-(4-methylpiperazin-1-yl)propyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[3-(4-methylpiperazin-1-yl)propyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170863220 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (E)-3-[2-[3-(4-methylpiperazin-1-yl)propyl]phenyl]prop-2-enoic acid |
| SMILES | CN1CCN(CCCc2ccccc2/C=C/C(=O)O)CC1 |
| InChI | InChI=1S/C17H24N2O2/c1-18-11-13-19(14-12-18)10-4-7-15-5-2-3-6-16(15)8-9-17(20)21/h2-3,5-6,8-9H,4,7,10-14H2,1H3,(H,20,21)/b9-8+ |
| InChIKey | NLBOTAVDJWUKCK-CMDGGOBGSA-N |
| XLogP | 1.96 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|