C18H26O4 — CID 142769412
(E)-3-[2-(4,6-dihydroxynonyl)phenyl]prop-2-enoic acid (PubChem CID 142769412) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (E)-3-[2-(4,6-dihydroxynonyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(4,6-dihydroxynonyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 142769412 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (E)-3-[2-(4,6-dihydroxynonyl)phenyl]prop-2-enoic acid |
| SMILES | CCCC(O)CC(O)CCCc1ccccc1/C=C/C(=O)O |
| InChI | InChI=1S/C18H26O4/c1-2-6-16(19)13-17(20)10-5-9-14-7-3-4-8-15(14)11-12-18(21)22/h3-4,7-8,11-12,16-17,19-20H,2,5-6,9-10,13H2,1H3,(H,21,22)/b12-11+ |
| InChIKey | BUPQWUGJOJLBNK-VAWYXSNFSA-N |
| XLogP | 3.02 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|