C14H22N2O3S — CID 170862354
2-[3-(4-methylpiperazin-1-yl)propyl]benzenesulfonic acid (PubChem CID 170862354) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-[3-(4-methylpiperazin-1-yl)propyl]benzenesulfonic acid.
| Compound Name | 2-[3-(4-methylpiperazin-1-yl)propyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 170862354 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-[3-(4-methylpiperazin-1-yl)propyl]benzenesulfonic acid |
| SMILES | CN1CCN(CCCc2ccccc2S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C14H22N2O3S/c1-15-9-11-16(12-10-15)8-4-6-13-5-2-3-7-14(13)20(17,18)19/h2-3,5,7H,4,6,8-12H2,1H3,(H,17,18,19) |
| InChIKey | LQFZNBAQRXLJEO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|