C15H20BrF3N2O2 — CID 171115502
1-[3-[2-bromo-5-(trifluoromethoxy)phenoxy]propyl]-4-methylpiperazine (PubChem CID 171115502) has the molecular formula C15H20BrF3N2O2 and a molecular weight of 397.24 g/mol. Its IUPAC name is 1-[3-[2-bromo-5-(trifluoromethoxy)phenoxy]propyl]-4-methylpiperazine.
| Compound Name | 1-[3-[2-bromo-5-(trifluoromethoxy)phenoxy]propyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 171115502 |
| Molecular Formula | C15H20BrF3N2O2 |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 1-[3-[2-bromo-5-(trifluoromethoxy)phenoxy]propyl]-4-methylpiperazine |
| SMILES | CN1CCN(CCCOc2cc(OC(F)(F)F)ccc2Br)CC1 |
| InChI | InChI=1S/C15H20BrF3N2O2/c1-20-6-8-21(9-7-20)5-2-10-22-14-11-12(3-4-13(14)16)23-15(17,18)19/h3-4,11H,2,5-10H2,1H3 |
| InChIKey | YLYDUEQLGUNQLT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|