C14H15BrF5NO2 — CID 171115669
1-[3-[2-bromo-4-(trifluoromethoxy)phenoxy]propyl]-3,3-difluoropyrrolidine (PubChem CID 171115669) has the molecular formula C14H15BrF5NO2 and a molecular weight of 404.17 g/mol. Its IUPAC name is 1-[3-[2-bromo-4-(trifluoromethoxy)phenoxy]propyl]-3,3-difluoropyrrolidine.
| Compound Name | 1-[3-[2-bromo-4-(trifluoromethoxy)phenoxy]propyl]-3,3-difluoropyrrolidine |
|---|---|
| PubChem CID | 171115669 |
| Molecular Formula | C14H15BrF5NO2 |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 1-[3-[2-bromo-4-(trifluoromethoxy)phenoxy]propyl]-3,3-difluoropyrrolidine |
| SMILES | FC1(F)CCN(CCCOc2ccc(OC(F)(F)F)cc2Br)C1 |
| InChI | InChI=1S/C14H15BrF5NO2/c15-11-8-10(23-14(18,19)20)2-3-12(11)22-7-1-5-21-6-4-13(16,17)9-21/h2-3,8H,1,4-7,9H2 |
| InChIKey | AEBPMXGDNNUSLY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|