C20H28BrF3N2O4 — CID 171115693
tert-butyl (3S)-4-[3-[2-bromo-4-(trifluoromethoxy)phenoxy]propyl]-3-methylpiperazine-1-carboxylate (PubChem CID 171115693) has the molecular formula C20H28BrF3N2O4 and a molecular weight of 497.35 g/mol. Its IUPAC name is tert-butyl (3S)-4-[3-[2-bromo-4-(trifluoromethoxy)phenoxy]propyl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-[3-[2-bromo-4-(trifluoromethoxy)phenoxy]propyl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 171115693 |
| Molecular Formula | C20H28BrF3N2O4 |
| Molecular Weight | 497.35 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | tert-butyl (3S)-4-[3-[2-bromo-4-(trifluoromethoxy)phenoxy]propyl]-3-methylpiperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)CCN1CCCOc1ccc(OC(F)(F)F)cc1Br |
| InChI | InChI=1S/C20H28BrF3N2O4/c1-14-13-26(18(27)30-19(2,3)4)10-9-25(14)8-5-11-28-17-7-6-15(12-16(17)21)29-20(22,23)24/h6-7,12,14H,5,8-11,13H2,1-4H3/t14-/m0/s1 |
| InChIKey | GVXNGVQSICAJLU-AWEZNQCLSA-N |
| XLogP | 5.06 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|