C15H17ClF3NO — CID 17156683
N-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methyl]propan-2-amine;hydrochloride (PubChem CID 17156683) has the molecular formula C15H17ClF3NO and a molecular weight of 319.75 g/mol. Its IUPAC name is N-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methyl]propan-2-amine;hydrochloride.
| Compound Name | N-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methyl]propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 17156683 |
| Molecular Formula | C15H17ClF3NO |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methyl]propan-2-amine;hydrochloride |
| SMILES | CC(C)NCc1ccc(-c2cccc(C(F)(F)F)c2)o1.Cl |
| InChI | InChI=1S/C15H16F3NO.ClH/c1-10(2)19-9-13-6-7-14(20-13)11-4-3-5-12(8-11)15(16,17)18;/h3-8,10,19H,9H2,1-2H3;1H |
| InChIKey | FFVMFIXVPPFCNN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |