C17H24F3N3O4S — CID 9493338
(2S)-N-(2-methoxyethyl)-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide (PubChem CID 9493338) has the molecular formula C17H24F3N3O4S and a molecular weight of 423.46 g/mol. Its IUPAC name is (2S)-N-(2-methoxyethyl)-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide.
| Compound Name | (2S)-N-(2-methoxyethyl)-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 9493338 |
| Molecular Formula | C17H24F3N3O4S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (2S)-N-(2-methoxyethyl)-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide |
| SMILES | COCCNC(=O)[C@H](C)N1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H24F3N3O4S/c1-13(16(24)21-6-11-27-2)22-7-9-23(10-8-22)28(25,26)15-5-3-4-14(12-15)17(18,19)20/h3-5,12-13H,6-11H2,1-2H3,(H,21,24)/t13-/m0/s1 |
| InChIKey | PTAFRUIQVOFFRD-ZDUSSCGKSA-N |
| XLogP | 1.16 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|