C16H22F3N3O3S — CID 8689356
(2S)-N-ethyl-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide (PubChem CID 8689356) has the molecular formula C16H22F3N3O3S and a molecular weight of 393.43 g/mol. Its IUPAC name is (2S)-N-ethyl-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide.
| Compound Name | (2S)-N-ethyl-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 8689356 |
| Molecular Formula | C16H22F3N3O3S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (2S)-N-ethyl-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide |
| SMILES | CCNC(=O)[C@H](C)N1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H22F3N3O3S/c1-3-20-15(23)12(2)21-7-9-22(10-8-21)26(24,25)14-6-4-5-13(11-14)16(17,18)19/h4-6,11-12H,3,7-10H2,1-2H3,(H,20,23)/t12-/m0/s1 |
| InChIKey | NGHIDWWNODDPEY-LBPRGKRZSA-N |
| XLogP | 1.54 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |