C12H14ClN3O3 — CID 44820958
5-[(4-chloropyrazol-1-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide (PubChem CID 44820958) has the molecular formula C12H14ClN3O3 and a molecular weight of 283.71 g/mol. Its IUPAC name is 5-[(4-chloropyrazol-1-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide.
| Compound Name | 5-[(4-chloropyrazol-1-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 44820958 |
| Molecular Formula | C12H14ClN3O3 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 5-[(4-chloropyrazol-1-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide |
| SMILES | COCCNC(=O)c1ccc(Cn2cc(Cl)cn2)o1 |
| InChI | InChI=1S/C12H14ClN3O3/c1-18-5-4-14-12(17)11-3-2-10(19-11)8-16-7-9(13)6-15-16/h2-3,6-7H,4-5,8H2,1H3,(H,14,17) |
| InChIKey | ADYMYVSTTGBHEI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|