C14H10Cl2N4O2 — CID 19578909
5-[(4-chloropyrazol-1-yl)methyl]-N-(2-chloro-3-pyridinyl)furan-2-carboxamide (PubChem CID 19578909) has the molecular formula C14H10Cl2N4O2 and a molecular weight of 337.17 g/mol. Its IUPAC name is 5-[(4-chloropyrazol-1-yl)methyl]-N-(2-chloro-3-pyridinyl)furan-2-carboxamide.
| Compound Name | 5-[(4-chloropyrazol-1-yl)methyl]-N-(2-chloro-3-pyridinyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19578909 |
| Molecular Formula | C14H10Cl2N4O2 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 5-[(4-chloropyrazol-1-yl)methyl]-N-(2-chloro-3-pyridinyl)furan-2-carboxamide |
| SMILES | O=C(Nc1cccnc1Cl)c1ccc(Cn2cc(Cl)cn2)o1 |
| InChI | InChI=1S/C14H10Cl2N4O2/c15-9-6-18-20(7-9)8-10-3-4-12(22-10)14(21)19-11-2-1-5-17-13(11)16/h1-7H,8H2,(H,19,21) |
| InChIKey | JIMXZNDMUDDANM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|