C18H14Cl2N2O3 — CID 1084332
5-[(4-chloro-3-methylphenoxy)methyl]-N-(2-chloro-3-pyridinyl)furan-2-carboxamide (PubChem CID 1084332) has the molecular formula C18H14Cl2N2O3 and a molecular weight of 377.23 g/mol. Its IUPAC name is 5-[(4-chloro-3-methylphenoxy)methyl]-N-(2-chloro-3-pyridinyl)furan-2-carboxamide.
| Compound Name | 5-[(4-chloro-3-methylphenoxy)methyl]-N-(2-chloro-3-pyridinyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 1084332 |
| Molecular Formula | C18H14Cl2N2O3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 5-[(4-chloro-3-methylphenoxy)methyl]-N-(2-chloro-3-pyridinyl)furan-2-carboxamide |
| SMILES | Cc1cc(OCc2ccc(C(=O)Nc3cccnc3Cl)o2)ccc1Cl |
| InChI | InChI=1S/C18H14Cl2N2O3/c1-11-9-12(4-6-14(11)19)24-10-13-5-7-16(25-13)18(23)22-15-3-2-8-21-17(15)20/h2-9H,10H2,1H3,(H,22,23) |
| InChIKey | KCZDDVIOFMNKLS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|