C21H18ClNO4 — CID 19416966
N-(4-acetylphenyl)-5-[(4-chloro-3-methylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19416966) has the molecular formula C21H18ClNO4 and a molecular weight of 383.83 g/mol. Its IUPAC name is N-(4-acetylphenyl)-5-[(4-chloro-3-methylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(4-acetylphenyl)-5-[(4-chloro-3-methylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19416966 |
| Molecular Formula | C21H18ClNO4 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N-(4-acetylphenyl)-5-[(4-chloro-3-methylphenoxy)methyl]furan-2-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccc(COc3ccc(Cl)c(C)c3)o2)cc1 |
| InChI | InChI=1S/C21H18ClNO4/c1-13-11-17(7-9-19(13)22)26-12-18-8-10-20(27-18)21(25)23-16-5-3-15(4-6-16)14(2)24/h3-11H,12H2,1-2H3,(H,23,25) |
| InChIKey | RKUVJTXUPLIFAS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |