C20H15ClNO5- — CID 4050771
4-[[5-[(4-chloro-3-methylphenoxy)methyl]furan-2-carbonyl]amino]benzoate (PubChem CID 4050771) has the molecular formula C20H15ClNO5- and a molecular weight of 384.80 g/mol. Its IUPAC name is 4-[[5-[(4-chloro-3-methylphenoxy)methyl]furan-2-carbonyl]amino]benzoate.
| Compound Name | 4-[[5-[(4-chloro-3-methylphenoxy)methyl]furan-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 4050771 |
| Molecular Formula | C20H15ClNO5- |
| Molecular Weight | 384.80 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 4-[[5-[(4-chloro-3-methylphenoxy)methyl]furan-2-carbonyl]amino]benzoate |
| SMILES | Cc1cc(OCc2ccc(C(=O)Nc3ccc(C(=O)[O-])cc3)o2)ccc1Cl |
| InChI | InChI=1S/C20H16ClNO5/c1-12-10-15(6-8-17(12)21)26-11-16-7-9-18(27-16)19(23)22-14-4-2-13(3-5-14)20(24)25/h2-10H,11H2,1H3,(H,22,23)(H,24,25)/p-1 |
| InChIKey | NDVLAYBAROYAKJ-UHFFFAOYSA-M |
| XLogP | 3.44 |
| TPSA | 91.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.80 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |