C14H18BrN3O3 — CID 19454922
5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide (PubChem CID 19454922) has the molecular formula C14H18BrN3O3 and a molecular weight of 356.22 g/mol. Its IUPAC name is 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide.
| Compound Name | 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19454922 |
| Molecular Formula | C14H18BrN3O3 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide |
| SMILES | COCCNC(=O)c1ccc(Cn2nc(C)c(Br)c2C)o1 |
| InChI | InChI=1S/C14H18BrN3O3/c1-9-13(15)10(2)18(17-9)8-11-4-5-12(21-11)14(19)16-6-7-20-3/h4-5H,6-8H2,1-3H3,(H,16,19) |
| InChIKey | SSLKLIFVNVAJTM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|