C14H15F4N3O3 — CID 19468113
5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-(2-methoxyethyl)furan-2-carboxamide (PubChem CID 19468113) has the molecular formula C14H15F4N3O3 and a molecular weight of 349.28 g/mol. Its IUPAC name is 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-(2-methoxyethyl)furan-2-carboxamide.
| Compound Name | 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-(2-methoxyethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19468113 |
| Molecular Formula | C14H15F4N3O3 |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-(2-methoxyethyl)furan-2-carboxamide |
| SMILES | COCCNC(=O)c1ccc(Cn2nc(C(F)F)cc2C(F)F)o1 |
| InChI | InChI=1S/C14H15F4N3O3/c1-23-5-4-19-14(22)11-3-2-8(24-11)7-21-10(13(17)18)6-9(20-21)12(15)16/h2-3,6,12-13H,4-5,7H2,1H3,(H,19,22) |
| InChIKey | VDWSDXHPKHSVQI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|