C17H9F8N3O2 — CID 19467889
5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-(2,3,5,6-tetrafluorophenyl)furan-2-carboxamide (PubChem CID 19467889) has the molecular formula C17H9F8N3O2 and a molecular weight of 439.26 g/mol. Its IUPAC name is 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-(2,3,5,6-tetrafluorophenyl)furan-2-carboxamide.
| Compound Name | 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-(2,3,5,6-tetrafluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19467889 |
| Molecular Formula | C17H9F8N3O2 |
| Molecular Weight | 439.26 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-(2,3,5,6-tetrafluorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)cc(F)c1F)c1ccc(Cn2nc(C(F)F)cc2C(F)F)o1 |
| InChI | InChI=1S/C17H9F8N3O2/c18-7-3-8(19)13(21)14(12(7)20)26-17(29)11-2-1-6(30-11)5-28-10(16(24)25)4-9(27-28)15(22)23/h1-4,15-16H,5H2,(H,26,29) |
| InChIKey | UACGJOPYKAPBKG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.26 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|