C13H13F4N3O2S — CID 19467994
5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-(2-sulfanylethyl)furan-2-carboxamide (PubChem CID 19467994) has the molecular formula C13H13F4N3O2S and a molecular weight of 351.33 g/mol. Its IUPAC name is 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-(2-sulfanylethyl)furan-2-carboxamide.
| Compound Name | 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-(2-sulfanylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19467994 |
| Molecular Formula | C13H13F4N3O2S |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-(2-sulfanylethyl)furan-2-carboxamide |
| SMILES | O=C(NCCS)c1ccc(Cn2nc(C(F)F)cc2C(F)F)o1 |
| InChI | InChI=1S/C13H13F4N3O2S/c14-11(15)8-5-9(12(16)17)20(19-8)6-7-1-2-10(22-7)13(21)18-3-4-23/h1-2,5,11-12,23H,3-4,6H2,(H,18,21) |
| InChIKey | FXFCDYVWNAGONP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|