C17H21F4N3O3 — CID 19468164
5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-(3-propan-2-yloxypropyl)furan-2-carboxamide (PubChem CID 19468164) has the molecular formula C17H21F4N3O3 and a molecular weight of 391.37 g/mol. Its IUPAC name is 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-(3-propan-2-yloxypropyl)furan-2-carboxamide.
| Compound Name | 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-(3-propan-2-yloxypropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19468164 |
| Molecular Formula | C17H21F4N3O3 |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-(3-propan-2-yloxypropyl)furan-2-carboxamide |
| SMILES | CC(C)OCCCNC(=O)c1ccc(Cn2nc(C(F)F)cc2C(F)F)o1 |
| InChI | InChI=1S/C17H21F4N3O3/c1-10(2)26-7-3-6-22-17(25)14-5-4-11(27-14)9-24-13(16(20)21)8-12(23-24)15(18)19/h4-5,8,10,15-16H,3,6-7,9H2,1-2H3,(H,22,25) |
| InChIKey | RJHNOVROSQWKGA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|