C25H20F4N4O5 — CID 19468053
5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]furan-2-carboxamide (PubChem CID 19468053) has the molecular formula C25H20F4N4O5 and a molecular weight of 532.45 g/mol. Its IUPAC name is 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19468053 |
| Molecular Formula | C25H20F4N4O5 |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)c(Oc2cc(NC(=O)c3ccc(Cn4nc(C(F)F)cc4C(F)F)o3)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C25H20F4N4O5/c1-13-3-4-14(2)22(7-13)38-18-9-15(8-16(10-18)33(35)36)30-25(34)21-6-5-17(37-21)12-32-20(24(28)29)11-19(31-32)23(26)27/h3-11,23-24H,12H2,1-2H3,(H,30,34) |
| InChIKey | SPNCMBXHNVKYIX-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|