C25H23N5O7 — CID 4765802
5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[3-(3,5-dimethylphenoxy)-5-nitrophenyl]furan-2-carboxamide (PubChem CID 4765802) has the molecular formula C25H23N5O7 and a molecular weight of 505.49 g/mol. Its IUPAC name is 5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[3-(3,5-dimethylphenoxy)-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[3-(3,5-dimethylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4765802 |
| Molecular Formula | C25H23N5O7 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[3-(3,5-dimethylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
| SMILES | Cc1cc(C)cc(Oc2cc(NC(=O)c3ccc(Cn4nc(C)c([N+](=O)[O-])c4C)o3)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C25H23N5O7/c1-14-7-15(2)9-21(8-14)36-22-11-18(10-19(12-22)29(32)33)26-25(31)23-6-5-20(37-23)13-28-17(4)24(30(34)35)16(3)27-28/h5-12H,13H2,1-4H3,(H,26,31) |
| InChIKey | XJMBGKHVYNUKLO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 155.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|