C24H21ClN4O5 — CID 19448450
5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[3-(2-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide (PubChem CID 19448450) has the molecular formula C24H21ClN4O5 and a molecular weight of 480.91 g/mol. Its IUPAC name is 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[3-(2-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[3-(2-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19448450 |
| Molecular Formula | C24H21ClN4O5 |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[3-(2-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
| SMILES | Cc1ccccc1Oc1cc(NC(=O)c2ccc(Cn3nc(C)c(Cl)c3C)o2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H21ClN4O5/c1-14-6-4-5-7-21(14)34-20-11-17(10-18(12-20)29(31)32)26-24(30)22-9-8-19(33-22)13-28-16(3)23(25)15(2)27-28/h4-12H,13H2,1-3H3,(H,26,30) |
| InChIKey | TZPOENQPOMHHSV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|