C23H19ClN4O4 — CID 19617378
5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[4-(2-nitrophenyl)phenyl]furan-2-carboxamide (PubChem CID 19617378) has the molecular formula C23H19ClN4O4 and a molecular weight of 450.88 g/mol. Its IUPAC name is 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[4-(2-nitrophenyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[4-(2-nitrophenyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19617378 |
| Molecular Formula | C23H19ClN4O4 |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[4-(2-nitrophenyl)phenyl]furan-2-carboxamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)Nc3ccc(-c4ccccc4[N+](=O)[O-])cc3)o2)c(C)c1Cl |
| InChI | InChI=1S/C23H19ClN4O4/c1-14-22(24)15(2)27(26-14)13-18-11-12-21(32-18)23(29)25-17-9-7-16(8-10-17)19-5-3-4-6-20(19)28(30)31/h3-12H,13H2,1-2H3,(H,25,29) |
| InChIKey | SLUXANYDHQILJP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|