C17H13Br2ClN4O4 — CID 19448346
5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2,6-dibromo-4-nitrophenyl)furan-2-carboxamide (PubChem CID 19448346) has the molecular formula C17H13Br2ClN4O4 and a molecular weight of 532.58 g/mol. Its IUPAC name is 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2,6-dibromo-4-nitrophenyl)furan-2-carboxamide.
| Compound Name | 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2,6-dibromo-4-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19448346 |
| Molecular Formula | C17H13Br2ClN4O4 |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 529.90 |
| IUPAC Name | 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2,6-dibromo-4-nitrophenyl)furan-2-carboxamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)Nc3c(Br)cc([N+](=O)[O-])cc3Br)o2)c(C)c1Cl |
| InChI | InChI=1S/C17H13Br2ClN4O4/c1-8-15(20)9(2)23(22-8)7-11-3-4-14(28-11)17(25)21-16-12(18)5-10(24(26)27)6-13(16)19/h3-6H,7H2,1-2H3,(H,21,25) |
| InChIKey | JJLNCKPZRUORLW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|