C12H9Br2ClN4O3 — CID 19476887
4-chloro-N-(2,6-dibromo-4-nitrophenyl)-1,3-dimethylpyrazole-5-carboxamide (PubChem CID 19476887) has the molecular formula C12H9Br2ClN4O3 and a molecular weight of 452.49 g/mol. Its IUPAC name is 4-chloro-N-(2,6-dibromo-4-nitrophenyl)-1,3-dimethylpyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-(2,6-dibromo-4-nitrophenyl)-1,3-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19476887 |
| Molecular Formula | C12H9Br2ClN4O3 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 449.87 |
| IUPAC Name | 4-chloro-N-(2,6-dibromo-4-nitrophenyl)-1,3-dimethylpyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)Nc2c(Br)cc([N+](=O)[O-])cc2Br)c1Cl |
| InChI | InChI=1S/C12H9Br2ClN4O3/c1-5-9(15)11(18(2)17-5)12(20)16-10-7(13)3-6(19(21)22)4-8(10)14/h3-4H,1-2H3,(H,16,20) |
| InChIKey | QGUUHZTUQPARKJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|