C13H12Br2N4O3 — CID 19525733
N-(2,6-dibromo-4-nitrophenyl)-2-(3,5-dimethylpyrazol-1-yl)acetamide (PubChem CID 19525733) has the molecular formula C13H12Br2N4O3 and a molecular weight of 432.07 g/mol. Its IUPAC name is N-(2,6-dibromo-4-nitrophenyl)-2-(3,5-dimethylpyrazol-1-yl)acetamide.
| Compound Name | N-(2,6-dibromo-4-nitrophenyl)-2-(3,5-dimethylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19525733 |
| Molecular Formula | C13H12Br2N4O3 |
| Molecular Weight | 432.07 g/mol |
| Exact Mass | 429.93 |
| IUPAC Name | N-(2,6-dibromo-4-nitrophenyl)-2-(3,5-dimethylpyrazol-1-yl)acetamide |
| SMILES | Cc1cc(C)n(CC(=O)Nc2c(Br)cc([N+](=O)[O-])cc2Br)n1 |
| InChI | InChI=1S/C13H12Br2N4O3/c1-7-3-8(2)18(17-7)6-12(20)16-13-10(14)4-9(19(21)22)5-11(13)15/h3-5H,6H2,1-2H3,(H,16,20) |
| InChIKey | PEMSPUXSEWWZKB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.07 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|