C11H7Br2N5O5 — CID 19515910
N-(2,6-dibromo-4-nitrophenyl)-2-(4-nitropyrazol-1-yl)acetamide (PubChem CID 19515910) has the molecular formula C11H7Br2N5O5 and a molecular weight of 449.02 g/mol. Its IUPAC name is N-(2,6-dibromo-4-nitrophenyl)-2-(4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-(2,6-dibromo-4-nitrophenyl)-2-(4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19515910 |
| Molecular Formula | C11H7Br2N5O5 |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 446.88 |
| IUPAC Name | N-(2,6-dibromo-4-nitrophenyl)-2-(4-nitropyrazol-1-yl)acetamide |
| SMILES | O=C(Cn1cc([N+](=O)[O-])cn1)Nc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C11H7Br2N5O5/c12-8-1-6(17(20)21)2-9(13)11(8)15-10(19)5-16-4-7(3-14-16)18(22)23/h1-4H,5H2,(H,15,19) |
| InChIKey | GAYOMXLHBYNWGR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|