C8H10N4O6 — CID 43357618
3-hydroxy-2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]propanoic acid (PubChem CID 43357618) has the molecular formula C8H10N4O6 and a molecular weight of 258.19 g/mol. Its IUPAC name is 3-hydroxy-2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]propanoic acid.
| Compound Name | 3-hydroxy-2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43357618 |
| Molecular Formula | C8H10N4O6 |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 3-hydroxy-2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]propanoic acid |
| SMILES | O=C(Cn1cc([N+](=O)[O-])cn1)NC(CO)C(=O)O |
| InChI | InChI=1S/C8H10N4O6/c13-4-6(8(15)16)10-7(14)3-11-2-5(1-9-11)12(17)18/h1-2,6,13H,3-4H2,(H,10,14)(H,15,16) |
| InChIKey | NPXCRYPXNFJBPO-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 147.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|