C10H11Br2N3O3 — CID 3630388
N-(2,6-dibromo-4-nitrophenyl)-2-(dimethylamino)acetamide (PubChem CID 3630388) has the molecular formula C10H11Br2N3O3 and a molecular weight of 381.02 g/mol. Its IUPAC name is N-(2,6-dibromo-4-nitrophenyl)-2-(dimethylamino)acetamide.
| Compound Name | N-(2,6-dibromo-4-nitrophenyl)-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 3630388 |
| Molecular Formula | C10H11Br2N3O3 |
| Molecular Weight | 381.02 g/mol |
| Exact Mass | 378.92 |
| IUPAC Name | N-(2,6-dibromo-4-nitrophenyl)-2-(dimethylamino)acetamide |
| SMILES | CN(C)CC(=O)Nc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C10H11Br2N3O3/c1-14(2)5-9(16)13-10-7(11)3-6(15(17)18)4-8(10)12/h3-4H,5H2,1-2H3,(H,13,16) |
| InChIKey | MFGPZRLQWBMFCR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.02 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|