C9H8Br2N4O3S — CID 3722374
[2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] carbamimidothioate (PubChem CID 3722374) has the molecular formula C9H8Br2N4O3S and a molecular weight of 412.06 g/mol. Its IUPAC name is [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] carbamimidothioate.
| Compound Name | [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] carbamimidothioate |
|---|---|
| PubChem CID | 3722374 |
| Molecular Formula | C9H8Br2N4O3S |
| Molecular Weight | 412.06 g/mol |
| Exact Mass | 409.87 |
| IUPAC Name | [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC(=O)Nc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C9H8Br2N4O3S/c10-5-1-4(15(17)18)2-6(11)8(5)14-7(16)3-19-9(12)13/h1-2H,3H2,(H3,12,13)(H,14,16) |
| InChIKey | NNKZAFZUHUIPOR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.06 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|