C11H14ClN3OS — CID 60722168
[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] carbamimidothioate (PubChem CID 60722168) has the molecular formula C11H14ClN3OS and a molecular weight of 271.77 g/mol. Its IUPAC name is [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] carbamimidothioate.
| Compound Name | [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] carbamimidothioate |
|---|---|
| PubChem CID | 60722168 |
| Molecular Formula | C11H14ClN3OS |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC(=O)Nc1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C11H14ClN3OS/c1-6-3-7(2)10(8(12)4-6)15-9(16)5-17-11(13)14/h3-4H,5H2,1-2H3,(H3,13,14)(H,15,16) |
| InChIKey | KSTZTJIZZAFEDF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|