C9H9Br3ClN3OS — CID 44783898
[2-oxo-2-(2,4,6-tribromoanilino)ethyl] carbamimidothioate;hydrochloride (PubChem CID 44783898) has the molecular formula C9H9Br3ClN3OS and a molecular weight of 482.42 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-tribromoanilino)ethyl] carbamimidothioate;hydrochloride.
| Compound Name | [2-oxo-2-(2,4,6-tribromoanilino)ethyl] carbamimidothioate;hydrochloride |
|---|---|
| PubChem CID | 44783898 |
| Molecular Formula | C9H9Br3ClN3OS |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 478.77 |
| IUPAC Name | [2-oxo-2-(2,4,6-tribromoanilino)ethyl] carbamimidothioate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)SCC(=O)Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C9H8Br3N3OS.ClH/c10-4-1-5(11)8(6(12)2-4)15-7(16)3-17-9(13)14;/h1-2H,3H2,(H3,13,14)(H,15,16);1H |
| InChIKey | SDNYBLYRFQGBNC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|