C10H11Br2N5OS — CID 83082429
[2-(2,4-dibromoanilino)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate (PubChem CID 83082429) has the molecular formula C10H11Br2N5OS and a molecular weight of 409.11 g/mol. Its IUPAC name is [2-(2,4-dibromoanilino)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate.
| Compound Name | [2-(2,4-dibromoanilino)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83082429 |
| Molecular Formula | C10H11Br2N5OS |
| Molecular Weight | 409.11 g/mol |
| Exact Mass | 406.91 |
| IUPAC Name | [2-(2,4-dibromoanilino)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCC(=O)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C10H11Br2N5OS/c11-5-1-2-7(6(12)3-5)16-8(18)4-19-10(15)17-9(13)14/h1-3H,4H2,(H,16,18)(H5,13,14,15,17) |
| InChIKey | ZRMRASBPJGPCMS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.11 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|