C9H10BrFN4S — CID 73213199
(4-bromo-2-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 73213199) has the molecular formula C9H10BrFN4S and a molecular weight of 305.18 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | (4-bromo-2-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 73213199 |
| Molecular Formula | C9H10BrFN4S |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | (4-bromo-2-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(/N=C(N)N)SCc1ccc(Br)cc1F |
| InChI | InChI=1S/C9H10BrFN4S/c10-6-2-1-5(7(11)3-6)4-16-9(14)15-8(12)13/h1-3H,4H2,(H5,12,13,14,15) |
| InChIKey | RBOCHWXORIPWDE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|