C10H11F3N4S — CID 11995630
[2-(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 11995630) has the molecular formula C10H11F3N4S and a molecular weight of 276.29 g/mol. Its IUPAC name is [2-(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | [2-(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 11995630 |
| Molecular Formula | C10H11F3N4S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | [2-(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C10H11F3N4S/c11-10(12,13)7-4-2-1-3-6(7)5-18-9(16)17-8(14)15/h1-4H,5H2,(H5,14,15,16,17) |
| InChIKey | DPVULTRNKVYJTM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|