C10H12N8S — CID 83083019
(1-phenyltetrazol-5-yl)methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 83083019) has the molecular formula C10H12N8S and a molecular weight of 276.33 g/mol. Its IUPAC name is (1-phenyltetrazol-5-yl)methyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | (1-phenyltetrazol-5-yl)methyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83083019 |
| Molecular Formula | C10H12N8S |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (1-phenyltetrazol-5-yl)methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C10H12N8S/c11-9(12)14-10(13)19-6-8-15-16-17-18(8)7-4-2-1-3-5-7/h1-5H,6H2,(H5,11,12,13,14) |
| InChIKey | HZFGGVBCMRQEOW-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 131.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|