C10H14N4OS — CID 83082788
(2-methoxyphenyl)methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 83082788) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is (2-methoxyphenyl)methyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | (2-methoxyphenyl)methyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83082788 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (2-methoxyphenyl)methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCc1ccccc1OC |
| InChI | InChI=1S/C10H14N4OS/c1-15-8-5-3-2-4-7(8)6-16-10(13)14-9(11)12/h2-5H,6H2,1H3,(H5,11,12,13,14) |
| InChIKey | SHJYRLMDMUPEBV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|