C10H14N4S — CID 11995627
(4-methylphenyl)methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 11995627) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is (4-methylphenyl)methyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | (4-methylphenyl)methyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 11995627 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (4-methylphenyl)methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(/N=C(N)N)SCc1ccc(C)cc1 |
| InChI | InChI=1S/C10H14N4S/c1-7-2-4-8(5-3-7)6-15-10(13)14-9(11)12/h2-5H,6H2,1H3,(H5,11,12,13,14) |
| InChIKey | IMHUDBQFIZGFJO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|