C17H19IN4O2S — CID 73213198
[3-[(4-iodophenyl)methoxy]-4-methoxyphenyl]methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 73213198) has the molecular formula C17H19IN4O2S and a molecular weight of 470.34 g/mol. Its IUPAC name is [3-[(4-iodophenyl)methoxy]-4-methoxyphenyl]methyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | [3-[(4-iodophenyl)methoxy]-4-methoxyphenyl]methyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 73213198 |
| Molecular Formula | C17H19IN4O2S |
| Molecular Weight | 470.34 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | [3-[(4-iodophenyl)methoxy]-4-methoxyphenyl]methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCc1ccc(OC)c(OCc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C17H19IN4O2S/c1-23-14-7-4-12(10-25-17(21)22-16(19)20)8-15(14)24-9-11-2-5-13(18)6-3-11/h2-8H,9-10H2,1H3,(H5,19,20,21,22) |
| InChIKey | XTTMXMRKFPIERH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|