C9H12N4O3S — CID 83083324
methyl 5-[[N-(diaminomethylidene)carbamimidoyl]sulfanylmethyl]furan-2-carboxylate (PubChem CID 83083324) has the molecular formula C9H12N4O3S and a molecular weight of 256.29 g/mol. Its IUPAC name is methyl 5-[[N-(diaminomethylidene)carbamimidoyl]sulfanylmethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[N-(diaminomethylidene)carbamimidoyl]sulfanylmethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 83083324 |
| Molecular Formula | C9H12N4O3S |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | methyl 5-[[N-(diaminomethylidene)carbamimidoyl]sulfanylmethyl]furan-2-carboxylate |
| SMILES | [H]/N=C(\N=C(N)N)SCc1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C9H12N4O3S/c1-15-7(14)6-3-2-5(16-6)4-17-9(12)13-8(10)11/h2-3H,4H2,1H3,(H5,10,11,12,13) |
| InChIKey | DGHXAVGZGIAPTC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|