C25H28N2O3S2 — CID 10073350
methyl 5-[[(E)-C-benzylsulfanyl-N-(2,6-diethylanilino)carbonimidoyl]sulfanylmethyl]furan-2-carboxylate (PubChem CID 10073350) has the molecular formula C25H28N2O3S2 and a molecular weight of 468.64 g/mol. Its IUPAC name is methyl 5-[[(E)-C-benzylsulfanyl-N-(2,6-diethylanilino)carbonimidoyl]sulfanylmethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(E)-C-benzylsulfanyl-N-(2,6-diethylanilino)carbonimidoyl]sulfanylmethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 10073350 |
| Molecular Formula | C25H28N2O3S2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | methyl 5-[[(E)-C-benzylsulfanyl-N-(2,6-diethylanilino)carbonimidoyl]sulfanylmethyl]furan-2-carboxylate |
| SMILES | CCc1cccc(CC)c1N/N=C(\SCc1ccccc1)SCc1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C25H28N2O3S2/c1-4-19-12-9-13-20(5-2)23(19)26-27-25(31-16-18-10-7-6-8-11-18)32-17-21-14-15-22(30-21)24(28)29-3/h6-15,26H,4-5,16-17H2,1-3H3/b27-25+ |
| InChIKey | AAPCIBMLMWEEIW-IMVLJIQESA-N |
| XLogP | 6.74 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|