C13H11Br2NO3 — CID 107597258
methyl 5-[(2,6-dibromoanilino)methyl]furan-2-carboxylate (PubChem CID 107597258) has the molecular formula C13H11Br2NO3 and a molecular weight of 389.04 g/mol. Its IUPAC name is methyl 5-[(2,6-dibromoanilino)methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(2,6-dibromoanilino)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 107597258 |
| Molecular Formula | C13H11Br2NO3 |
| Molecular Weight | 389.04 g/mol |
| Exact Mass | 386.91 |
| IUPAC Name | methyl 5-[(2,6-dibromoanilino)methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CNc2c(Br)cccc2Br)o1 |
| InChI | InChI=1S/C13H11Br2NO3/c1-18-13(17)11-6-5-8(19-11)7-16-12-9(14)3-2-4-10(12)15/h2-6,16H,7H2,1H3 |
| InChIKey | AOFGJRGYDZDTKX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.04 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |