C12H13N5S — CID 83083220
quinolin-6-ylmethyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 83083220) has the molecular formula C12H13N5S and a molecular weight of 259.34 g/mol. Its IUPAC name is quinolin-6-ylmethyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | quinolin-6-ylmethyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83083220 |
| Molecular Formula | C12H13N5S |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | quinolin-6-ylmethyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCc1ccc2ncccc2c1 |
| InChI | InChI=1S/C12H13N5S/c13-11(14)17-12(15)18-7-8-3-4-10-9(6-8)2-1-5-16-10/h1-6H,7H2,(H5,13,14,15,17) |
| InChIKey | PBXFAVDOKQCZDP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|