C9H11Cl2FN4S — CID 68625912
(2-chloro-4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate;hydrochloride (PubChem CID 68625912) has the molecular formula C9H11Cl2FN4S and a molecular weight of 297.19 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate;hydrochloride.
| Compound Name | (2-chloro-4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate;hydrochloride |
|---|---|
| PubChem CID | 68625912 |
| Molecular Formula | C9H11Cl2FN4S |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | (2-chloro-4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate;hydrochloride |
| SMILES | Cl.[H]/N=C(/N=C(N)N)SCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C9H10ClFN4S.ClH/c10-7-3-6(11)2-1-5(7)4-16-9(14)15-8(12)13;/h1-3H,4H2,(H5,12,13,14,15);1H |
| InChIKey | YPKFBSIMDRGTHX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|